About di(imidazol-1-yloxy)borinic acid;quinoline
di(imidazol-1-yloxy)borinic acid;quinoline (PubChem CID 174795092) has the molecular formula C15H14BN5O3
and a molecular weight of 323.12 g/mol. Its IUPAC name is di(imidazol-1-yloxy)borinic acid;quinoline.
Molecular Properties
| Compound Name | di(imidazol-1-yloxy)borinic acid;quinoline |
| PubChem CID | 174795092 |
| Molecular Formula | C15H14BN5O3 |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | di(imidazol-1-yloxy)borinic acid;quinoline |
| SMILES | OB(On1ccnc1)On1ccnc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H7BN4O3/c1-2-6-9-8(4-1)5-3-7-10-9;12-7(13-10-3-1-8-5-10)14-11-4-2-9-6-11/h1-7H;1-6,12H |
| InChIKey | BXXSFZGPHGWDSH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(imidazol-1-yloxy)borinic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(imidazol-1-yloxy)borinic acid;quinoline?
The IUPAC name of di(imidazol-1-yloxy)borinic acid;quinoline (CID 174795092) is di(imidazol-1-yloxy)borinic acid;quinoline.
What is the SMILES notation for di(imidazol-1-yloxy)borinic acid;quinoline?
The canonical SMILES for di(imidazol-1-yloxy)borinic acid;quinoline is OB(On1ccnc1)On1ccnc1.c1ccc2ncccc2c1.
What is the InChIKey of di(imidazol-1-yloxy)borinic acid;quinoline?
The InChIKey is BXXSFZGPHGWDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H7BN4O3/c1-2-6-9-8(4-1)5-3-7-10-9;12-7(13-10-3-1-8-5-10)14-11-4-2-9-6-11/h1-7H;1-6,12H.
What are the key properties of di(imidazol-1-yloxy)borinic acid;quinoline?
di(imidazol-1-yloxy)borinic acid;quinoline has a molecular weight of 323.12 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for di(imidazol-1-yloxy)borinic acid;quinoline is sourced from PubChem (CID 174795092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).