About 3-nitroporphyrin-2-amine
3-nitroporphyrin-2-amine (PubChem CID 175149542) has the molecular formula C20H12N6O2
and a molecular weight of 368.36 g/mol. Its IUPAC name is 3-nitroporphyrin-2-amine.
Molecular Properties
| Compound Name | 3-nitroporphyrin-2-amine |
| PubChem CID | 175149542 |
| Molecular Formula | C20H12N6O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-nitroporphyrin-2-amine |
| SMILES | NC1=C([N+](=O)[O-])/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C20H12N6O2/c21-19-17-9-15-5-3-13(23-15)7-11-1-2-12(22-11)8-14-4-6-16(24-14)10-18(25-17)20(19)26(27)28/h1-10H,21H2/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10- |
| InChIKey | NRSSDSDWLASYFX-ITJRXXQTSA-N |
| XLogP | 2.47 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitroporphyrin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitroporphyrin-2-amine?
The IUPAC name of 3-nitroporphyrin-2-amine (CID 175149542) is 3-nitroporphyrin-2-amine.
What is the SMILES notation for 3-nitroporphyrin-2-amine?
The canonical SMILES for 3-nitroporphyrin-2-amine is NC1=C([N+](=O)[O-])/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.
What is the InChIKey of 3-nitroporphyrin-2-amine?
The InChIKey is NRSSDSDWLASYFX-ITJRXXQTSA-N. The full InChI is InChI=1S/C20H12N6O2/c21-19-17-9-15-5-3-13(23-15)7-11-1-2-12(22-11)8-14-4-6-16(24-14)10-18(25-17)20(19)26(27)28/h1-10H,21H2/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10-.
What are the key properties of 3-nitroporphyrin-2-amine?
3-nitroporphyrin-2-amine has a molecular weight of 368.36 g/mol, XLogP of 2.47, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitroporphyrin-2-amine is sourced from PubChem (CID 175149542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).