About 1,4-dibromoisoquinoline;quinoline
1,4-dibromoisoquinoline;quinoline (PubChem CID 175324607) has the molecular formula C18H12Br2N2
and a molecular weight of 416.12 g/mol. Its IUPAC name is 1,4-dibromoisoquinoline;quinoline.
Molecular Properties
| Compound Name | 1,4-dibromoisoquinoline;quinoline |
| PubChem CID | 175324607 |
| Molecular Formula | C18H12Br2N2 |
| Molecular Weight | 416.12 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 1,4-dibromoisoquinoline;quinoline |
| SMILES | Brc1cnc(Br)c2ccccc12.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H5Br2N.C9H7N/c10-8-5-12-9(11)7-4-2-1-3-6(7)8;1-2-6-9-8(4-1)5-3-7-10-9/h1-5H;1-7H |
| InChIKey | UKEXWFPGZUWKEF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.12 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromoisoquinoline;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromoisoquinoline;quinoline?
The IUPAC name of 1,4-dibromoisoquinoline;quinoline (CID 175324607) is 1,4-dibromoisoquinoline;quinoline.
What is the SMILES notation for 1,4-dibromoisoquinoline;quinoline?
The canonical SMILES for 1,4-dibromoisoquinoline;quinoline is Brc1cnc(Br)c2ccccc12.c1ccc2ncccc2c1.
What is the InChIKey of 1,4-dibromoisoquinoline;quinoline?
The InChIKey is UKEXWFPGZUWKEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2N.C9H7N/c10-8-5-12-9(11)7-4-2-1-3-6(7)8;1-2-6-9-8(4-1)5-3-7-10-9/h1-5H;1-7H.
What are the key properties of 1,4-dibromoisoquinoline;quinoline?
1,4-dibromoisoquinoline;quinoline has a molecular weight of 416.12 g/mol, XLogP of 5.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromoisoquinoline;quinoline is sourced from PubChem (CID 175324607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).