About CID 175543320
CID 175543320 (PubChem CID 175543320) has the molecular formula C14H12N4OPb
and a molecular weight of 459.48 g/mol.
Molecular Properties
| Compound Name | CID 175543320 |
| PubChem CID | 175543320 |
| Molecular Formula | C14H12N4OPb |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | — |
| SMILES | NC(=O)c1ccccc1.[Pb].c1cnc2cncnc2c1 |
| InChI | InChI=1S/C7H5N3.C7H7NO.Pb/c1-2-6-7(9-3-1)4-8-5-10-6;8-7(9)6-4-2-1-3-5-6;/h1-5H;1-5H,(H2,8,9); |
| InChIKey | XGRLXCZAKGRAKH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 175543320 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175543320?
The IUPAC name of CID 175543320 (CID 175543320) is not available.
What is the SMILES notation for CID 175543320?
The canonical SMILES for CID 175543320 is NC(=O)c1ccccc1.[Pb].c1cnc2cncnc2c1.
What is the InChIKey of CID 175543320?
The InChIKey is XGRLXCZAKGRAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3.C7H7NO.Pb/c1-2-6-7(9-3-1)4-8-5-10-6;8-7(9)6-4-2-1-3-5-6;/h1-5H;1-5H,(H2,8,9);.
What are the key properties of CID 175543320?
CID 175543320 has a molecular weight of 459.48 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175543320 is sourced from PubChem (CID 175543320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).