C30H31ClO4 — CID 175657691
2-[4-benzyl-2-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid (PubChem CID 175657691) has the molecular formula C30H31ClO4 and a molecular weight of 491.03 g/mol. Its IUPAC name is 2-[4-benzyl-2-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-benzyl-2-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 175657691 |
| Molecular Formula | C30H31ClO4 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[4-benzyl-2-[(2R,3S,6S)-6-[(4-chlorophenyl)methyl]-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1CC[C@@H](Cc2ccc(Cl)cc2)O[C@H]1c1cc(Cc2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C30H31ClO4/c1-20(2)26-14-13-25(17-22-8-11-24(31)12-9-22)35-30(26)27-18-23(16-21-6-4-3-5-7-21)10-15-28(27)34-19-29(32)33/h3-12,15,18,25-26,30H,1,13-14,16-17,19H2,2H3,(H,32,33)/t25-,26-,30+/m0/s1 |
| InChIKey | QCNRRHLNWVMPPI-BRWNIOCJSA-N |
| XLogP | 7.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|