C11H23IN4 — CID 176543093
N-[N'-(4-ethyl-4-methylhexyl)carbamimidoyl]carbamimidoyl iodide (PubChem CID 176543093) has the molecular formula C11H23IN4 and a molecular weight of 338.24 g/mol. Its IUPAC name is N-[N'-(4-ethyl-4-methylhexyl)carbamimidoyl]carbamimidoyl iodide.
| Compound Name | N-[N'-(4-ethyl-4-methylhexyl)carbamimidoyl]carbamimidoyl iodide |
|---|---|
| PubChem CID | 176543093 |
| Molecular Formula | C11H23IN4 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[N'-(4-ethyl-4-methylhexyl)carbamimidoyl]carbamimidoyl iodide |
| SMILES | [H]/N=C(\I)N/C(N)=N/CCCC(C)(CC)CC |
| InChI | InChI=1S/C11H23IN4/c1-4-11(3,5-2)7-6-8-15-10(14)16-9(12)13/h4-8H2,1-3H3,(H4,13,14,15,16) |
| InChIKey | LUKPGGZUMAHDCU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|