C18H18Cl2N2O4 — CID 177397965
2,4-dichloro-6-[(E)-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]oxypropoxyiminomethyl]phenol (PubChem CID 177397965) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]oxypropoxyiminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]oxypropoxyiminomethyl]phenol |
|---|---|
| PubChem CID | 177397965 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2,4-dichloro-6-[(E)-3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]oxypropoxyiminomethyl]phenol |
| SMILES | C/C(=N\OCCCO/N=C/c1cc(Cl)cc(Cl)c1O)c1ccccc1O |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-12(15-5-2-3-6-17(15)23)22-26-8-4-7-25-21-11-13-9-14(19)10-16(20)18(13)24/h2-3,5-6,9-11,23-24H,4,7-8H2,1H3/b21-11+,22-12+ |
| InChIKey | MURHVHZDLNUOEB-XHQRYOPUSA-N |
| XLogP | 4.59 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|