C53H43N5O2S — CID 177405783
(Z)-2-cyano-3-[4-[15-(4-methylthiophen-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 177405783) has the molecular formula C53H43N5O2S and a molecular weight of 814.03 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[15-(4-methylthiophen-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[4-[15-(4-methylthiophen-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177405783 |
| Molecular Formula | C53H43N5O2S |
| Molecular Weight | 814.03 g/mol |
| Exact Mass | 813.31 |
| IUPAC Name | (Z)-2-cyano-3-[4-[15-(4-methylthiophen-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1csc(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4ccc(/C=C(/C#N)C(=O)O)cc4)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C53H43N5O2S/c1-28-20-31(4)47(32(5)21-28)51-42-16-12-38(55-42)49(36-10-8-35(9-11-36)25-37(26-54)53(59)60)39-13-17-43(56-39)52(48-33(6)22-29(2)23-34(48)7)45-19-15-41(58-45)50(40-14-18-44(51)57-40)46-24-30(3)27-61-46/h8-25,27,55,58H,1-7H3,(H,59,60)/b37-25-,49-38-,49-39-,50-40+,50-41+,51-42+,51-44+,52-43+,52-45+ |
| InChIKey | YRLJVJITUJLARX-FFUDNDCFSA-N |
| XLogP | 13.54 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.03 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|