C51H58O4 — CID 177433617
2,6-ditert-butyl-4-[5,6-dibenzoyl-3-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-7,7-dimethyl-2-bicyclo[2.2.1]hept-5-enylidene]cyclohexa-2,5-dien-1-one (PubChem CID 177433617) has the molecular formula C51H58O4 and a molecular weight of 735.02 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[5,6-dibenzoyl-3-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-7,7-dimethyl-2-bicyclo[2.2.1]hept-5-enylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[5,6-dibenzoyl-3-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-7,7-dimethyl-2-bicyclo[2.2.1]hept-5-enylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 177433617 |
| Molecular Formula | C51H58O4 |
| Molecular Weight | 735.02 g/mol |
| Exact Mass | 734.43 |
| IUPAC Name | 2,6-ditert-butyl-4-[5,6-dibenzoyl-3-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-7,7-dimethyl-2-bicyclo[2.2.1]hept-5-enylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=C2C(=C3C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C3)C3C(C(=O)c4ccccc4)=C(C(=O)c4ccccc4)C2C3(C)C)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C51H58O4/c1-47(2,3)33-25-31(26-34(45(33)54)48(4,5)6)37-38(32-27-35(49(7,8)9)46(55)36(28-32)50(10,11)12)42-40(44(53)30-23-19-16-20-24-30)39(41(37)51(42,13)14)43(52)29-21-17-15-18-22-29/h15-28,41-42H,1-14H3 |
| InChIKey | PIXHLNHWEDGDLJ-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.02 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |