C29H39NO3Si — CID 177450930
methyl (2S,5S,6S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-1-azaspiro[4.5]decane-2-carboxylate (PubChem CID 177450930) has the molecular formula C29H39NO3Si and a molecular weight of 477.72 g/mol. Its IUPAC name is methyl (2S,5S,6S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-1-azaspiro[4.5]decane-2-carboxylate.
| Compound Name | methyl (2S,5S,6S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-1-azaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 177450930 |
| Molecular Formula | C29H39NO3Si |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | methyl (2S,5S,6S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-1-azaspiro[4.5]decane-2-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC[C@]12CC[C@@H](C(=O)OC)N2 |
| InChI | InChI=1S/C29H39NO3Si/c1-6-24-26(18-13-20-29(24)21-19-25(30-29)27(31)32-5)33-34(28(2,3)4,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h6-12,14-17,24-26,30H,1,13,18-21H2,2-5H3/t24-,25+,26+,29+/m1/s1 |
| InChIKey | ORLXLWMDXAQYBU-NVGWLYTESA-N |
| XLogP | 4.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|