C7H12N4O — CID 18334362
4-(ethylamino)-1,6-dimethyl-1,3,5-triazin-2-one (PubChem CID 18334362) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-(ethylamino)-1,6-dimethyl-1,3,5-triazin-2-one.
| Compound Name | 4-(ethylamino)-1,6-dimethyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 18334362 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-(ethylamino)-1,6-dimethyl-1,3,5-triazin-2-one |
| SMILES | CCNc1nc(C)n(C)c(=O)n1 |
| InChI | InChI=1S/C7H12N4O/c1-4-8-6-9-5(2)11(3)7(12)10-6/h4H2,1-3H3,(H,8,10,12) |
| InChIKey | ITZKXULAZKSIAK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |