C23H24Cl2N2O2 — CID 18682647
5-benzyl-1-cyclohexyl-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 18682647) has the molecular formula C23H24Cl2N2O2 and a molecular weight of 431.36 g/mol. Its IUPAC name is 5-benzyl-1-cyclohexyl-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-benzyl-1-cyclohexyl-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18682647 |
| Molecular Formula | C23H24Cl2N2O2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 5-benzyl-1-cyclohexyl-3-(3,5-dichlorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(Cc2ccccc2)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C23H24Cl2N2O2/c1-23(15-16-8-4-2-5-9-16)21(28)26(20-13-17(24)12-18(25)14-20)22(29)27(23)19-10-6-3-7-11-19/h2,4-5,8-9,12-14,19H,3,6-7,10-11,15H2,1H3 |
| InChIKey | LBBMKKSAGGQELW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|