C34H51NO4Si2 — CID 18953745
4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1-pyridin-3-ylbutane-1,3-diol (PubChem CID 18953745) has the molecular formula C34H51NO4Si2 and a molecular weight of 593.96 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1-pyridin-3-ylbutane-1,3-diol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1-pyridin-3-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 18953745 |
| Molecular Formula | C34H51NO4Si2 |
| Molecular Weight | 593.96 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1-pyridin-3-ylbutane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(O)C(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(O)c1cccnc1 |
| InChI | InChI=1S/C34H51NO4Si2/c1-33(2,3)40(7,8)39-26-31(36)30(32(37)27-17-15-23-35-25-27)22-16-24-38-41(34(4,5)6,28-18-11-9-12-19-28)29-20-13-10-14-21-29/h9-15,17-21,23,25,30-32,36-37H,16,22,24,26H2,1-8H3 |
| InChIKey | PSLVOUZUDDMILU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.96 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|