C35H42N2O5 — CID 19772196
1-[2-[3-[(E)-2-[6-[4-(4-ethoxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2-oxoethyl]cyclohexane-1-carboxylic acid (PubChem CID 19772196) has the molecular formula C35H42N2O5 and a molecular weight of 570.73 g/mol. Its IUPAC name is 1-[2-[3-[(E)-2-[6-[4-(4-ethoxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2-oxoethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-[3-[(E)-2-[6-[4-(4-ethoxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2-oxoethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19772196 |
| Molecular Formula | C35H42N2O5 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 1-[2-[3-[(E)-2-[6-[4-(4-ethoxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2-oxoethyl]cyclohexane-1-carboxylic acid |
| SMILES | CCOc1ccc(CCCCOCc2cccc(/C=C/c3cccc(NC(=O)CC4(C(=O)O)CCCCC4)c3)n2)cc1 |
| InChI | InChI=1S/C35H42N2O5/c1-2-42-32-19-16-27(17-20-32)10-4-7-23-41-26-31-14-9-12-29(36-31)18-15-28-11-8-13-30(24-28)37-33(38)25-35(34(39)40)21-5-3-6-22-35/h8-9,11-20,24H,2-7,10,21-23,25-26H2,1H3,(H,37,38)(H,39,40)/b18-15+ |
| InChIKey | KMOOOCNTTMKFMD-OBGWFSINSA-N |
| XLogP | 7.55 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|