C38H46N4O5 — CID 19772238
2,2-diethyl-4-[3-[(E)-2-[6-[4-[4-(3-imidazol-1-ylpropoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid (PubChem CID 19772238) has the molecular formula C38H46N4O5 and a molecular weight of 638.81 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[(E)-2-[6-[4-[4-(3-imidazol-1-ylpropoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[(E)-2-[6-[4-[4-(3-imidazol-1-ylpropoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19772238 |
| Molecular Formula | C38H46N4O5 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.35 |
| IUPAC Name | 2,2-diethyl-4-[3-[(E)-2-[6-[4-[4-(3-imidazol-1-ylpropoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(/C=C/c2cccc(COCCCCc3ccc(OCCCn4ccnc4)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C38H46N4O5/c1-3-38(4-2,37(44)45)27-36(43)41-33-13-7-11-31(26-33)15-18-32-12-8-14-34(40-32)28-46-24-6-5-10-30-16-19-35(20-17-30)47-25-9-22-42-23-21-39-29-42/h7-8,11-21,23,26,29H,3-6,9-10,22,24-25,27-28H2,1-2H3,(H,41,43)(H,44,45)/b18-15+ |
| InChIKey | KNOQRRMEEPHEEJ-OBGWFSINSA-N |
| XLogP | 7.68 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|