C33H40N2O5 — CID 67877778
4-[3-[(E)-2-[6-[6-(3,4-dihydroxyphenyl)hexyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid (PubChem CID 67877778) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is 4-[3-[(E)-2-[6-[6-(3,4-dihydroxyphenyl)hexyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-[3-[(E)-2-[6-[6-(3,4-dihydroxyphenyl)hexyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67877778 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 4-[3-[(E)-2-[6-[6-(3,4-dihydroxyphenyl)hexyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(/C=C/c2cccc(CCCCCCc3ccc(O)c(O)c3)n2)c1)C(=O)O |
| InChI | InChI=1S/C33H40N2O5/c1-3-33(4-2,32(39)40)23-31(38)35-28-16-9-12-24(21-28)17-19-27-15-10-14-26(34-27)13-8-6-5-7-11-25-18-20-29(36)30(37)22-25/h9-10,12,14-22,36-37H,3-8,11,13,23H2,1-2H3,(H,35,38)(H,39,40)/b19-17+ |
| InChIKey | PYRHSNGZDLZAFC-HTXNQAPBSA-N |
| XLogP | 7.23 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|