C36H46N2O5 — CID 54486971
2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxy]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid (PubChem CID 54486971) has the molecular formula C36H46N2O5 and a molecular weight of 586.77 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxy]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxy]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54486971 |
| Molecular Formula | C36H46N2O5 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxy]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(C=Cc2cccc(OCCCCc3ccc(OCCC(C)C)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C36H46N2O5/c1-5-36(6-2,35(40)41)26-33(39)37-31-14-9-12-29(25-31)16-19-30-13-10-15-34(38-30)43-23-8-7-11-28-17-20-32(21-18-28)42-24-22-27(3)4/h9-10,12-21,25,27H,5-8,11,22-24,26H2,1-4H3,(H,37,39)(H,40,41) |
| InChIKey | XSZPCHWUBMTKBU-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|