C36H48N2O4 — CID 67877810
2,2-diethyl-4-[3-[2-[6-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid (PubChem CID 67877810) has the molecular formula C36H48N2O4 and a molecular weight of 572.79 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[6-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[6-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 67877810 |
| Molecular Formula | C36H48N2O4 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[6-[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid |
| SMILES | CCC(CC)(CCNc1cccc(C=Cc2cccc(COCCCCc3ccc(OC(C)(C)C)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C36H48N2O4/c1-6-36(7-2,34(39)40)23-24-37-31-15-10-13-29(26-31)17-20-30-14-11-16-32(38-30)27-41-25-9-8-12-28-18-21-33(22-19-28)42-35(3,4)5/h10-11,13-22,26,37H,6-9,12,23-25,27H2,1-5H3,(H,39,40) |
| InChIKey | MSWIWZXQDOKAED-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|