C35H47ClN2O3 — CID 67877918
ethyl 2,2-diethyl-4-[3-[2-[6-[4-(4-methylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoate;hydrochloride (PubChem CID 67877918) has the molecular formula C35H47ClN2O3 and a molecular weight of 579.23 g/mol. Its IUPAC name is ethyl 2,2-diethyl-4-[3-[2-[6-[4-(4-methylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoate;hydrochloride.
| Compound Name | ethyl 2,2-diethyl-4-[3-[2-[6-[4-(4-methylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 67877918 |
| Molecular Formula | C35H47ClN2O3 |
| Molecular Weight | 579.23 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | ethyl 2,2-diethyl-4-[3-[2-[6-[4-(4-methylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoate;hydrochloride |
| SMILES | CCOC(=O)C(CC)(CC)CCNc1cccc(C=Cc2cccc(COCCCCc3ccc(C)cc3)n2)c1.Cl |
| InChI | InChI=1S/C35H46N2O3.ClH/c1-5-35(6-2,34(38)40-7-3)23-24-36-32-15-10-13-30(26-32)21-22-31-14-11-16-33(37-31)27-39-25-9-8-12-29-19-17-28(4)18-20-29;/h10-11,13-22,26,36H,5-9,12,23-25,27H2,1-4H3;1H |
| InChIKey | SGWJLOTXNFZDKU-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.23 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|