C35H42N2O6 — CID 139601353
2,2-diethyl-4-oxo-4-[3-[(E)-2-[6-[4-(4-propanoyloxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid (PubChem CID 139601353) has the molecular formula C35H42N2O6 and a molecular weight of 586.73 g/mol. Its IUPAC name is 2,2-diethyl-4-oxo-4-[3-[(E)-2-[6-[4-(4-propanoyloxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid.
| Compound Name | 2,2-diethyl-4-oxo-4-[3-[(E)-2-[6-[4-(4-propanoyloxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 139601353 |
| Molecular Formula | C35H42N2O6 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 2,2-diethyl-4-oxo-4-[3-[(E)-2-[6-[4-(4-propanoyloxyphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]butanoic acid |
| SMILES | CCC(=O)Oc1ccc(CCCCOCc2cccc(/C=C/c3cccc(NC(=O)CC(CC)(CC)C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C35H42N2O6/c1-4-33(39)43-31-20-17-26(18-21-31)11-7-8-22-42-25-30-15-10-13-28(36-30)19-16-27-12-9-14-29(23-27)37-32(38)24-35(5-2,6-3)34(40)41/h9-10,12-21,23H,4-8,11,22,24-25H2,1-3H3,(H,37,38)(H,40,41)/b19-16+ |
| InChIKey | NFTZSHVZSFWNJX-KNTRCKAVSA-N |
| XLogP | 7.33 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|