C37H47NO4 — CID 67877820
4-[3-[(E)-2-[3-[4-(4-butylphenyl)butoxymethyl]phenyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid (PubChem CID 67877820) has the molecular formula C37H47NO4 and a molecular weight of 569.79 g/mol. Its IUPAC name is 4-[3-[(E)-2-[3-[4-(4-butylphenyl)butoxymethyl]phenyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-[3-[(E)-2-[3-[4-(4-butylphenyl)butoxymethyl]phenyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67877820 |
| Molecular Formula | C37H47NO4 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.35 |
| IUPAC Name | 4-[3-[(E)-2-[3-[4-(4-butylphenyl)butoxymethyl]phenyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCCCc1ccc(CCCCOCc2cccc(/C=C/c3cccc(NC(=O)CC(CC)(CC)C(=O)O)c3)c2)cc1 |
| InChI | InChI=1S/C37H47NO4/c1-4-7-12-29-18-20-30(21-19-29)13-8-9-24-42-28-33-16-10-14-31(25-33)22-23-32-15-11-17-34(26-32)38-35(39)27-37(5-2,6-3)36(40)41/h10-11,14-23,25-26H,4-9,12-13,24,27-28H2,1-3H3,(H,38,39)(H,40,41)/b23-22+ |
| InChIKey | KQPZSRHEZSSVPS-GHVJWSGMSA-N |
| XLogP | 8.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|