C36H46N2O4 — CID 19772300
4-[3-[(E)-2-[6-[4-(4-tert-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid (PubChem CID 19772300) has the molecular formula C36H46N2O4 and a molecular weight of 570.77 g/mol. Its IUPAC name is 4-[3-[(E)-2-[6-[4-(4-tert-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-[3-[(E)-2-[6-[4-(4-tert-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19772300 |
| Molecular Formula | C36H46N2O4 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | 4-[3-[(E)-2-[6-[4-(4-tert-butylphenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(/C=C/c2cccc(COCCCCc3ccc(C(C)(C)C)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C36H46N2O4/c1-6-36(7-2,34(40)41)25-33(39)38-31-15-10-13-28(24-31)19-22-30-14-11-16-32(37-30)26-42-23-9-8-12-27-17-20-29(21-18-27)35(3,4)5/h10-11,13-22,24H,6-9,12,23,25-26H2,1-5H3,(H,38,39)(H,40,41)/b22-19+ |
| InChIKey | TZGWNTSZUUBALG-ZBJSNUHESA-N |
| XLogP | 8.31 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|