C36H42N2O3 — CID 67877824
2,2-diethyl-4-[3-[2-[7-(4-phenylbutoxymethyl)quinolin-2-yl]ethenyl]anilino]butanoic acid (PubChem CID 67877824) has the molecular formula C36H42N2O3 and a molecular weight of 550.74 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[7-(4-phenylbutoxymethyl)quinolin-2-yl]ethenyl]anilino]butanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[7-(4-phenylbutoxymethyl)quinolin-2-yl]ethenyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 67877824 |
| Molecular Formula | C36H42N2O3 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[7-(4-phenylbutoxymethyl)quinolin-2-yl]ethenyl]anilino]butanoic acid |
| SMILES | CCC(CC)(CCNc1cccc(C=Cc2ccc3ccc(COCCCCc4ccccc4)cc3n2)c1)C(=O)O |
| InChI | InChI=1S/C36H42N2O3/c1-3-36(4-2,35(39)40)22-23-37-33-15-10-14-29(25-33)17-20-32-21-19-31-18-16-30(26-34(31)38-32)27-41-24-9-8-13-28-11-6-5-7-12-28/h5-7,10-12,14-21,25-26,37H,3-4,8-9,13,22-24,27H2,1-2H3,(H,39,40) |
| InChIKey | GRFWQIPGZGVBNP-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|