C35H42N2O5 — CID 88502627
4-[3-[(E)-2-[6-[4-(4-cyclopropyloxyphenyl)butoxy]-3-methyl-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid (PubChem CID 88502627) has the molecular formula C35H42N2O5 and a molecular weight of 570.73 g/mol. Its IUPAC name is 4-[3-[(E)-2-[6-[4-(4-cyclopropyloxyphenyl)butoxy]-3-methyl-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-[3-[(E)-2-[6-[4-(4-cyclopropyloxyphenyl)butoxy]-3-methyl-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88502627 |
| Molecular Formula | C35H42N2O5 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 4-[3-[(E)-2-[6-[4-(4-cyclopropyloxyphenyl)butoxy]-3-methyl-2-pyridinyl]ethenyl]anilino]-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(/C=C/c2nc(OCCCCc3ccc(OC4CC4)cc3)ccc2C)c1)C(=O)O |
| InChI | InChI=1S/C35H42N2O5/c1-4-35(5-2,34(39)40)24-32(38)36-28-11-8-10-27(23-28)15-20-31-25(3)12-21-33(37-31)41-22-7-6-9-26-13-16-29(17-14-26)42-30-18-19-30/h8,10-17,20-21,23,30H,4-7,9,18-19,22,24H2,1-3H3,(H,36,38)(H,39,40)/b20-15+ |
| InChIKey | UFANCROLQNGXAI-HMMYKYKNSA-N |
| XLogP | 7.72 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|