C12H9ClN2O5S — CID 19800072
ethyl 2-[(6-chloro-2-nitro-1-benzothiophen-3-yl)amino]-2-oxoacetate (PubChem CID 19800072) has the molecular formula C12H9ClN2O5S and a molecular weight of 328.73 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-2-nitro-1-benzothiophen-3-yl)amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(6-chloro-2-nitro-1-benzothiophen-3-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 19800072 |
| Molecular Formula | C12H9ClN2O5S |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | ethyl 2-[(6-chloro-2-nitro-1-benzothiophen-3-yl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1c([N+](=O)[O-])sc2cc(Cl)ccc12 |
| InChI | InChI=1S/C12H9ClN2O5S/c1-2-20-12(17)10(16)14-9-7-4-3-6(13)5-8(7)21-11(9)15(18)19/h3-5H,2H2,1H3,(H,14,16) |
| InChIKey | LJQVTYZYVISPLK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|