C42H77N7O2 — CID 20583585
2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 20583585) has the molecular formula C42H77N7O2 and a molecular weight of 712.12 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20583585 |
| Molecular Formula | C42H77N7O2 |
| Molecular Weight | 712.12 g/mol |
| Exact Mass | 711.61 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(c1nc(C)nc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C42H77N7O2/c1-12-14-26-46(33-28-39(4,5)48(40(6,7)29-33)50-35-22-18-16-19-23-35)37-43-32(3)44-38(45-37)47(27-15-13-2)34-30-41(8,9)49(42(10,11)31-34)51-36-24-20-17-21-25-36/h33-36H,12-31H2,1-11H3 |
| InChIKey | KGXZDIRMSSTAGI-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.12 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |