C34H41N3O4 — CID 20731647
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethyl 2-[(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]benzoate (PubChem CID 20731647) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethyl 2-[(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]benzoate.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethyl 2-[(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]benzoate |
|---|---|
| PubChem CID | 20731647 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethyl 2-[(7-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]benzoate |
| SMILES | CCC(C)(C)c1ccc(OCCOC(=O)c2ccccc2Cn2nnc3cc(C)ccc3c2=O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C34H41N3O4/c1-8-33(4,5)25-15-17-30(28(21-25)34(6,7)9-2)40-18-19-41-32(39)26-13-11-10-12-24(26)22-37-31(38)27-16-14-23(3)20-29(27)35-36-37/h10-17,20-21H,8-9,18-19,22H2,1-7H3 |
| InChIKey | QGOUDVJOHPNBAI-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|