C17H29N11S — CID 21104202
1-[4-(3,5-diaminopiperidin-1-yl)-6-[(4-methyl-1,3-thiazol-2-yl)amino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 21104202) has the molecular formula C17H29N11S and a molecular weight of 419.56 g/mol. Its IUPAC name is 1-[4-(3,5-diaminopiperidin-1-yl)-6-[(4-methyl-1,3-thiazol-2-yl)amino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-[(4-methyl-1,3-thiazol-2-yl)amino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 21104202 |
| Molecular Formula | C17H29N11S |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-[(4-methyl-1,3-thiazol-2-yl)amino]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | Cc1csc(Nc2nc(N3CC(N)CC(N)C3)nc(N3CC(N)CC(N)C3)n2)n1 |
| InChI | InChI=1S/C17H29N11S/c1-9-8-29-17(22-9)25-14-23-15(27-4-10(18)2-11(19)5-27)26-16(24-14)28-6-12(20)3-13(21)7-28/h8,10-13H,2-7,18-21H2,1H3,(H,22,23,24,25,26) |
| InChIKey | HSPGPUAUKLHIME-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 174.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |