C14H10N2O2 — CID 22057045
biphenylene-1,2-dicarboxamide (PubChem CID 22057045) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is biphenylene-1,2-dicarboxamide.
| Compound Name | biphenylene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 22057045 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | biphenylene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(c1C(N)=O)=c1ccccc1=2 |
| InChI | InChI=1S/C14H10N2O2/c15-13(17)10-6-5-9-7-3-1-2-4-8(7)11(9)12(10)14(16)18/h1-6H,(H2,15,17)(H2,16,18) |
| InChIKey | IZJXFQMRFRXZJB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |