C25H27F6O5- — CID 22080396
4-(ethoxymethoxy)cyclohexane-1-carboxylate;1-(1,1,2,3,3,3-hexafluoropropoxy)-4-phenylbenzene (PubChem CID 22080396) has the molecular formula C25H27F6O5- and a molecular weight of 521.47 g/mol. Its IUPAC name is 4-(ethoxymethoxy)cyclohexane-1-carboxylate;1-(1,1,2,3,3,3-hexafluoropropoxy)-4-phenylbenzene.
| Compound Name | 4-(ethoxymethoxy)cyclohexane-1-carboxylate;1-(1,1,2,3,3,3-hexafluoropropoxy)-4-phenylbenzene |
|---|---|
| PubChem CID | 22080396 |
| Molecular Formula | C25H27F6O5- |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-(ethoxymethoxy)cyclohexane-1-carboxylate;1-(1,1,2,3,3,3-hexafluoropropoxy)-4-phenylbenzene |
| SMILES | CCOCOC1CCC(C(=O)[O-])CC1.FC(C(F)(F)F)C(F)(F)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H10F6O.C10H18O4/c16-13(14(17,18)19)15(20,21)22-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-13-7-14-9-5-3-8(4-6-9)10(11)12/h1-9,13H;8-9H,2-7H2,1H3,(H,11,12)/p-1 |
| InChIKey | LXCUUDWXKTVEGK-UHFFFAOYSA-M |
| XLogP | 5.53 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|