C24H16F3N3O2 — CID 2321374
(2E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-3-oxo-2-(2-oxo-1H-indol-3-ylidene)propanenitrile (PubChem CID 2321374) has the molecular formula C24H16F3N3O2 and a molecular weight of 435.41 g/mol. Its IUPAC name is (2E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-3-oxo-2-(2-oxo-1H-indol-3-ylidene)propanenitrile.
| Compound Name | (2E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-3-oxo-2-(2-oxo-1H-indol-3-ylidene)propanenitrile |
|---|---|
| PubChem CID | 2321374 |
| Molecular Formula | C24H16F3N3O2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (2E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-3-oxo-2-(2-oxo-1H-indol-3-ylidene)propanenitrile |
| SMILES | Cc1cc(C(=O)/C(C#N)=C2/C(=O)Nc3ccccc32)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16F3N3O2/c1-13-10-18(14(2)30(13)16-7-5-6-15(11-16)24(25,26)27)22(31)19(12-28)21-17-8-3-4-9-20(17)29-23(21)32/h3-11H,1-2H3,(H,29,32)/b21-19+ |
| InChIKey | UKTWLNCYOSYDTK-XUTLUUPISA-N |
| XLogP | 5.23 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|