C16H5ClF12OSi — CID 23523526
chloro-ethoxy-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane (PubChem CID 23523526) has the molecular formula C16H5ClF12OSi and a molecular weight of 504.73 g/mol. Its IUPAC name is chloro-ethoxy-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane.
| Compound Name | chloro-ethoxy-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane |
|---|---|
| PubChem CID | 23523526 |
| Molecular Formula | C16H5ClF12OSi |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | chloro-ethoxy-(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane |
| SMILES | CCO[Si](Cl)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(C(F)=C(F)F)c(F)c1F |
| InChI | InChI=1S/C16H5ClF12OSi/c1-2-30-31(17,15-12(26)8(22)7(21)9(23)13(15)27)14-10(24)4(18)3(5(19)11(14)25)6(20)16(28)29/h2H2,1H3 |
| InChIKey | NHJLHNJZUCXFDD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|