C14H20Cl2N8 — CID 23616709
(1E)-1-[amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;triazine;hydrochloride (PubChem CID 23616709) has the molecular formula C14H20Cl2N8 and a molecular weight of 371.28 g/mol. Its IUPAC name is (1E)-1-[amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;triazine;hydrochloride.
| Compound Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;triazine;hydrochloride |
|---|---|
| PubChem CID | 23616709 |
| Molecular Formula | C14H20Cl2N8 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;triazine;hydrochloride |
| SMILES | CC(C)/N=C(N)/N=C(\N)Nc1ccc(Cl)cc1.Cl.c1cnnnc1 |
| InChI | InChI=1S/C11H16ClN5.C3H3N3.ClH/c1-7(2)15-10(13)17-11(14)16-9-5-3-8(12)4-6-9;1-2-4-6-5-3-1;/h3-7H,1-2H3,(H5,13,14,15,16,17);1-3H;1H |
| InChIKey | AGVJUQBOCCVSID-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|