C11H17Cl2N5 — CID 57347456
1-[amino-(4-chloro-2,3,5,6-tetradeuterioanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride (PubChem CID 57347456) has the molecular formula C11H17Cl2N5 and a molecular weight of 294.22 g/mol. Its IUPAC name is 1-[amino-(4-chloro-2,3,5,6-tetradeuterioanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride.
| Compound Name | 1-[amino-(4-chloro-2,3,5,6-tetradeuterioanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 57347456 |
| Molecular Formula | C11H17Cl2N5 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-[amino-(4-chloro-2,3,5,6-tetradeuterioanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride |
| SMILES | Cl.[2H]c1c([2H])c(NC(N)=N/C(N)=N/C(C)C)c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C11H16ClN5.ClH/c1-7(2)15-10(13)17-11(14)16-9-5-3-8(12)4-6-9;/h3-7H,1-2H3,(H5,13,14,15,16,17);1H/i3D,4D,5D,6D; |
| InChIKey | SARMGXPVOFNNNG-HGSONKNXSA-N |
| XLogP | 2.21 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|