C13H20ClN5S — CID 134119147
(1E)-1-[amino-(3-chloro-4-ethylsulfanylanilino)methylidene]-2-propan-2-ylguanidine (PubChem CID 134119147) has the molecular formula C13H20ClN5S and a molecular weight of 313.86 g/mol. Its IUPAC name is (1E)-1-[amino-(3-chloro-4-ethylsulfanylanilino)methylidene]-2-propan-2-ylguanidine.
| Compound Name | (1E)-1-[amino-(3-chloro-4-ethylsulfanylanilino)methylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 134119147 |
| Molecular Formula | C13H20ClN5S |
| Molecular Weight | 313.86 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (1E)-1-[amino-(3-chloro-4-ethylsulfanylanilino)methylidene]-2-propan-2-ylguanidine |
| SMILES | CCSc1ccc(N/C(N)=N/C(N)=N/C(C)C)cc1Cl |
| InChI | InChI=1S/C13H20ClN5S/c1-4-20-11-6-5-9(7-10(11)14)18-13(16)19-12(15)17-8(2)3/h5-8H,4H2,1-3H3,(H5,15,16,17,18,19) |
| InChIKey | BRIPEAHVOPLIIR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.86 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|