C20H20Cl2N2O6 — CID 24538206
N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide (PubChem CID 24538206) has the molecular formula C20H20Cl2N2O6 and a molecular weight of 455.29 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
|---|---|
| PubChem CID | 24538206 |
| Molecular Formula | C20H20Cl2N2O6 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc2c1OCCO2 |
| InChI | InChI=1S/C20H20Cl2N2O6/c1-27-16-9-12(10-17-19(16)30-8-7-29-17)20(26)24-23-18(25)3-2-6-28-15-5-4-13(21)11-14(15)22/h4-5,9-11H,2-3,6-8H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | SAELISLTEJDMAF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|