C12H24F8INO3Si — CID 3077859
2-[bis(2-oxidoethyl)amino]ethanolate;1,1,2,2,3,3,4,4-octafluoro-6-iodohexane;silicon(4+) (PubChem CID 3077859) has the molecular formula C12H24F8INO3Si and a molecular weight of 537.30 g/mol. Its IUPAC name is 2-[bis(2-oxidoethyl)amino]ethanolate;1,1,2,2,3,3,4,4-octafluoro-6-iodohexane;silicon(4+).
| Compound Name | 2-[bis(2-oxidoethyl)amino]ethanolate;1,1,2,2,3,3,4,4-octafluoro-6-iodohexane;silicon(4+) |
|---|---|
| PubChem CID | 3077859 |
| Molecular Formula | C12H24F8INO3Si |
| Molecular Weight | 537.30 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | 2-[bis(2-oxidoethyl)amino]ethanolate;1,1,2,2,3,3,4,4-octafluoro-6-iodohexane;silicon(4+) |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C[CH-]I.[O-]CCN(CC[O-])CC[O-].[SiH8+4] |
| InChI | InChI=1S/C6H4F8I.C6H12NO3.H8Si/c7-3(8)5(11,12)6(13,14)4(9,10)1-2-15;8-4-1-7(2-5-9)3-6-10;/h2-3H,1H2;1-6H2;1H8/q-1;-3;+4 |
| InChIKey | FXHQZDVEHSLQRH-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.30 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|