C19H24F3N5O — CID 3229259
1-[(1-cyclopentyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-ol (PubChem CID 3229259) has the molecular formula C19H24F3N5O and a molecular weight of 395.43 g/mol. Its IUPAC name is 1-[(1-cyclopentyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-[(1-cyclopentyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 3229259 |
| Molecular Formula | C19H24F3N5O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[(1-cyclopentyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-ol |
| SMILES | OC1CCN(C(c2ccc(C(F)(F)F)cc2)c2nnnn2C2CCCC2)CC1 |
| InChI | InChI=1S/C19H24F3N5O/c20-19(21,22)14-7-5-13(6-8-14)17(26-11-9-16(28)10-12-26)18-23-24-25-27(18)15-3-1-2-4-15/h5-8,15-17,28H,1-4,9-12H2 |
| InChIKey | HWUBGIMYDHHRNI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |