C13H17N3O3S2 — CID 43603730
N-[4-(3-amino-4-hydroxyphenyl)-1,3-thiazol-2-yl]butane-1-sulfonamide (PubChem CID 43603730) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[4-(3-amino-4-hydroxyphenyl)-1,3-thiazol-2-yl]butane-1-sulfonamide.
| Compound Name | N-[4-(3-amino-4-hydroxyphenyl)-1,3-thiazol-2-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 43603730 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[4-(3-amino-4-hydroxyphenyl)-1,3-thiazol-2-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1nc(-c2ccc(O)c(N)c2)cs1 |
| InChI | InChI=1S/C13H17N3O3S2/c1-2-3-6-21(18,19)16-13-15-11(8-20-13)9-4-5-12(17)10(14)7-9/h4-5,7-8,17H,2-3,6,14H2,1H3,(H,15,16) |
| InChIKey | OTHDPAQOABEUOB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|