C23H39IO4Si2 — CID 46178119
(6aR,8S,9aS)-8-(4-iodophenyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 46178119) has the molecular formula C23H39IO4Si2 and a molecular weight of 562.64 g/mol. Its IUPAC name is (6aR,8S,9aS)-8-(4-iodophenyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | (6aR,8S,9aS)-8-(4-iodophenyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 46178119 |
| Molecular Formula | C23H39IO4Si2 |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | (6aR,8S,9aS)-8-(4-iodophenyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@H](c3ccc(I)cc3)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C23H39IO4Si2/c1-15(2)29(16(3)4)25-14-23-22(27-30(28-29,17(5)6)18(7)8)13-21(26-23)19-9-11-20(24)12-10-19/h9-12,15-18,21-23H,13-14H2,1-8H3/t21-,22-,23+/m0/s1 |
| InChIKey | CVUWSAJFTBAGLB-RJGXRXQPSA-N |
| XLogP | 7.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|