C30H66O5Si3 — CID 50901910
(3R,4S,5S,6R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3,5-dimethyl-4,6-bis(triethylsilyloxy)nonan-2-one (PubChem CID 50901910) has the molecular formula C30H66O5Si3 and a molecular weight of 591.11 g/mol. Its IUPAC name is (3R,4S,5S,6R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3,5-dimethyl-4,6-bis(triethylsilyloxy)nonan-2-one.
| Compound Name | (3R,4S,5S,6R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3,5-dimethyl-4,6-bis(triethylsilyloxy)nonan-2-one |
|---|---|
| PubChem CID | 50901910 |
| Molecular Formula | C30H66O5Si3 |
| Molecular Weight | 591.11 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | (3R,4S,5S,6R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3,5-dimethyl-4,6-bis(triethylsilyloxy)nonan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)[C@@H](C[C@H](COC)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC)[C@@H](C)C(C)=O |
| InChI | InChI=1S/C30H66O5Si3/c1-16-37(17-2,18-3)34-28(22-27(23-32-13)33-36(14,15)30(10,11)12)25(8)29(24(7)26(9)31)35-38(19-4,20-5)21-6/h24-25,27-29H,16-23H2,1-15H3/t24-,25-,27+,28+,29+/m0/s1 |
| InChIKey | KNYNUFATWKQVFJ-GZGDWUIASA-N |
| XLogP | 9.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.11 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|