C48H88O4S2Si4 — CID 53362870
[(3S,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[tert-butyl(diphenyl)silyl]oxy-8-(1,3-dithian-2-yl)-8-methylnonan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 53362870) has the molecular formula C48H88O4S2Si4 and a molecular weight of 905.71 g/mol. Its IUPAC name is [(3S,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[tert-butyl(diphenyl)silyl]oxy-8-(1,3-dithian-2-yl)-8-methylnonan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[tert-butyl(diphenyl)silyl]oxy-8-(1,3-dithian-2-yl)-8-methylnonan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53362870 |
| Molecular Formula | C48H88O4S2Si4 |
| Molecular Weight | 905.71 g/mol |
| Exact Mass | 904.52 |
| IUPAC Name | [(3S,5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[tert-butyl(diphenyl)silyl]oxy-8-(1,3-dithian-2-yl)-8-methylnonan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C1SCCCS1)[C@H](C[C@@H](C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C48H88O4S2Si4/c1-44(2,3)55(15,16)50-38(32-33-49-58(47(10,11)12,40-28-23-21-24-29-40)41-30-25-22-26-31-41)36-39(51-56(17,18)45(4,5)6)37-42(52-57(19,20)46(7,8)9)48(13,14)43-53-34-27-35-54-43/h21-26,28-31,38-39,42-43H,27,32-37H2,1-20H3/t38-,39+,42-/m0/s1 |
| InChIKey | YKXIZOSTZLCIBJ-RDFJTFJDSA-N |
| XLogP | 14.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.71 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|