C18H27N5O6 — CID 54061836
N-[3-(2,4-dinitroanilino)propyl]-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide (PubChem CID 54061836) has the molecular formula C18H27N5O6 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[3-(2,4-dinitroanilino)propyl]-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide.
| Compound Name | N-[3-(2,4-dinitroanilino)propyl]-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 54061836 |
| Molecular Formula | C18H27N5O6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[3-(2,4-dinitroanilino)propyl]-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
| SMILES | CC1(C)CC(C(=O)NCCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(C)(C)N1O |
| InChI | InChI=1S/C18H27N5O6/c1-17(2)11-13(18(3,4)23(17)29)16(24)20-9-5-8-19-14-7-6-12(21(25)26)10-15(14)22(27)28/h6-7,10,13,19,29H,5,8-9,11H2,1-4H3,(H,20,24) |
| InChIKey | PYKGXZMBIPKSFJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|