C17H18Cl2N4O3 — CID 54111641
3-amino-N-carbamoyl-N-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]ethyl]propanamide (PubChem CID 54111641) has the molecular formula C17H18Cl2N4O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is 3-amino-N-carbamoyl-N-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]ethyl]propanamide.
| Compound Name | 3-amino-N-carbamoyl-N-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]ethyl]propanamide |
|---|---|
| PubChem CID | 54111641 |
| Molecular Formula | C17H18Cl2N4O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-amino-N-carbamoyl-N-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]ethyl]propanamide |
| SMILES | NCCC(=O)N(CC/N=C/c1ccc(-c2ccc(Cl)c(Cl)c2)o1)C(N)=O |
| InChI | InChI=1S/C17H18Cl2N4O3/c18-13-3-1-11(9-14(13)19)15-4-2-12(26-15)10-22-7-8-23(17(21)25)16(24)5-6-20/h1-4,9-10H,5-8,20H2,(H2,21,25)/b22-10+ |
| InChIKey | NHNRYIOAELZSOB-LSHDLFTRSA-N |
| XLogP | 2.93 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|