C25H54O4Si — CID 54228663
(12,12-dimethoxy-2,2,4,4,6,6,8,8-octamethyldodecyl)-dimethoxy-methylsilane (PubChem CID 54228663) has the molecular formula C25H54O4Si and a molecular weight of 446.79 g/mol. Its IUPAC name is (12,12-dimethoxy-2,2,4,4,6,6,8,8-octamethyldodecyl)-dimethoxy-methylsilane.
| Compound Name | (12,12-dimethoxy-2,2,4,4,6,6,8,8-octamethyldodecyl)-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 54228663 |
| Molecular Formula | C25H54O4Si |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | (12,12-dimethoxy-2,2,4,4,6,6,8,8-octamethyldodecyl)-dimethoxy-methylsilane |
| SMILES | COC(CCCC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)C[Si](C)(OC)OC)OC |
| InChI | InChI=1S/C25H54O4Si/c1-22(2,16-14-15-21(26-9)27-10)17-23(3,4)18-24(5,6)19-25(7,8)20-30(13,28-11)29-12/h21H,14-20H2,1-13H3 |
| InChIKey | QHQQAXYFFLMLNZ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|