C15H12S3 — CID 54514965
5-prop-1-enyl-2,3-dithiophen-2-ylthiophene (PubChem CID 54514965) has the molecular formula C15H12S3 and a molecular weight of 288.46 g/mol. Its IUPAC name is 5-prop-1-enyl-2,3-dithiophen-2-ylthiophene.
| Compound Name | 5-prop-1-enyl-2,3-dithiophen-2-ylthiophene |
|---|---|
| PubChem CID | 54514965 |
| Molecular Formula | C15H12S3 |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 5-prop-1-enyl-2,3-dithiophen-2-ylthiophene |
| SMILES | CC=Cc1cc(-c2cccs2)c(-c2cccs2)s1 |
| InChI | InChI=1S/C15H12S3/c1-2-5-11-10-12(13-6-3-8-16-13)15(18-11)14-7-4-9-17-14/h2-10H,1H3 |
| InChIKey | YLUBWGFDPZZLNE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |