C11H3BrF16O — CID 550629
5-bromo-1,3,4,4,6,6-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-5-(trifluoromethyl)cyclohexene (PubChem CID 550629) has the molecular formula C11H3BrF16O and a molecular weight of 535.02 g/mol. Its IUPAC name is 5-bromo-1,3,4,4,6,6-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-5-(trifluoromethyl)cyclohexene.
| Compound Name | 5-bromo-1,3,4,4,6,6-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-5-(trifluoromethyl)cyclohexene |
|---|---|
| PubChem CID | 550629 |
| Molecular Formula | C11H3BrF16O |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 533.91 |
| IUPAC Name | 5-bromo-1,3,4,4,6,6-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methoxy-5-(trifluoromethyl)cyclohexene |
| SMILES | COC1(F)C(C(F)(F)C(F)(F)C(F)(F)F)=C(F)C(F)(F)C(Br)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C11H3BrF16O/c1-29-6(18)2(4(14,15)8(19,20)11(26,27)28)3(13)5(16,17)7(12,9(6,21)22)10(23,24)25/h1H3 |
| InChIKey | FQEZXMJCRJMARE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|