C19H31NO2 — CID 57037520
2,4-ditert-butyl-6-(2,2-dimethyl-1-nitrosopropyl)phenol (PubChem CID 57037520) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(2,2-dimethyl-1-nitrosopropyl)phenol.
| Compound Name | 2,4-ditert-butyl-6-(2,2-dimethyl-1-nitrosopropyl)phenol |
|---|---|
| PubChem CID | 57037520 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 2,4-ditert-butyl-6-(2,2-dimethyl-1-nitrosopropyl)phenol |
| SMILES | CC(C)(C)c1cc(C(N=O)C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO2/c1-17(2,3)12-10-13(16(20-22)19(7,8)9)15(21)14(11-12)18(4,5)6/h10-11,16,21H,1-9H3 |
| InChIKey | XOCNBZXGWBWMLW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|