C32H41F7N2O5 — CID 57111497
5-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-hydroxyphenyl]-N-hydroxyhexanamide (PubChem CID 57111497) has the molecular formula C32H41F7N2O5 and a molecular weight of 666.68 g/mol. Its IUPAC name is 5-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-hydroxyphenyl]-N-hydroxyhexanamide.
| Compound Name | 5-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-hydroxyphenyl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 57111497 |
| Molecular Formula | C32H41F7N2O5 |
| Molecular Weight | 666.68 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 5-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-hydroxyphenyl]-N-hydroxyhexanamide |
| SMILES | CCC(C)(C)c1ccc(OC(C)CCCC(=O)N(O)c2ccc(O)c(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C32H41F7N2O5/c1-8-28(4,5)20-13-16-25(22(17-20)29(6,7)9-2)46-19(3)11-10-12-26(43)41(45)21-14-15-24(42)23(18-21)40-27(44)30(33,34)31(35,36)32(37,38)39/h13-19,42,45H,8-12H2,1-7H3,(H,40,44) |
| InChIKey | VRJJVVGPNLOVIM-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.68 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|