About CID 58060881
CID 58060881 (PubChem CID 58060881) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol.
Molecular Properties
| Compound Name | CID 58060881 |
| PubChem CID | 58060881 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | — |
| SMILES | [CH][C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C8H14/c1-7-5-3-4-6-8(7)2/h1,7-8H,3-6H2,2H3/t7-,8-/m0/s1 |
| InChIKey | QUDDLNDFIOMDLP-YUMQZZPRSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 58060881 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58060881?
The IUPAC name of CID 58060881 (CID 58060881) is not available.
What is the SMILES notation for CID 58060881?
The canonical SMILES for CID 58060881 is [CH][C@H]1CCCC[C@@H]1C.
What is the InChIKey of CID 58060881?
The InChIKey is QUDDLNDFIOMDLP-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H14/c1-7-5-3-4-6-8(7)2/h1,7-8H,3-6H2,2H3/t7-,8-/m0/s1.
What are the key properties of CID 58060881?
CID 58060881 has a molecular weight of 110.20 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58060881 is sourced from PubChem (CID 58060881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).